C30H28Cl2N2O4 — CID 19127967
[2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate (PubChem CID 19127967) has the molecular formula C30H28Cl2N2O4 and a molecular weight of 551.47 g/mol. Its IUPAC name is [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate.
| Compound Name | [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
|---|---|
| PubChem CID | 19127967 |
| Molecular Formula | C30H28Cl2N2O4 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C30H28Cl2N2O4/c1-5-12-36-27-23(31)13-18(14-24(27)32)29(35)37-20-10-11-21-25(15-20)38-28(34)22(16-33)26(21)17-6-8-19(9-7-17)30(2,3)4/h6-11,13-15,26H,5,12,34H2,1-4H3 |
| InChIKey | PEDUKOKKZZVPOW-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|