C27H20Cl4N2O4 — CID 19128376
[2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 19128376) has the molecular formula C27H20Cl4N2O4 and a molecular weight of 578.28 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 19128376 |
| Molecular Formula | C27H20Cl4N2O4 |
| Molecular Weight | 578.28 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C27H20Cl4N2O4/c1-2-3-8-35-25-21(30)9-14(10-22(25)31)27(34)36-16-5-7-18-23(12-16)37-26(33)19(13-32)24(18)17-6-4-15(28)11-20(17)29/h4-7,9-12,24H,2-3,8,33H2,1H3 |
| InChIKey | GOVZAYLVPHEMDJ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.28 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|