C34H36Cl2N2O6 — CID 19129024
[2-amino-3-cyano-4-(4-hexoxy-3-methoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 19129024) has the molecular formula C34H36Cl2N2O6 and a molecular weight of 639.58 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-hexoxy-3-methoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-hexoxy-3-methoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 19129024 |
| Molecular Formula | C34H36Cl2N2O6 |
| Molecular Weight | 639.58 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | [2-amino-3-cyano-4-(4-hexoxy-3-methoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | CCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc(Cl)c(OCCCC)c(Cl)c4)ccc32)cc1OC |
| InChI | InChI=1S/C34H36Cl2N2O6/c1-4-6-8-9-15-41-28-13-10-21(18-30(28)40-3)31-24-12-11-23(19-29(24)44-33(38)25(31)20-37)43-34(39)22-16-26(35)32(27(36)17-22)42-14-7-5-2/h10-13,16-19,31H,4-9,14-15,38H2,1-3H3 |
| InChIKey | OLHNDPGRJCNMSQ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.58 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|