C30H28Cl2N2O6 — CID 19124830
[2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate (PubChem CID 19124830) has the molecular formula C30H28Cl2N2O6 and a molecular weight of 583.47 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
|---|---|
| PubChem CID | 19124830 |
| Molecular Formula | C30H28Cl2N2O6 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-(2-methylpropoxy)phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCC(C)C)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C30H28Cl2N2O6/c1-5-37-28-22(31)10-18(11-23(28)32)30(35)39-19-7-8-20-25(13-19)40-29(34)21(14-33)27(20)17-6-9-24(26(12-17)36-4)38-15-16(2)3/h6-13,16,27H,5,15,34H2,1-4H3 |
| InChIKey | PJJKTMJTDKNANW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|