C35H29Cl2FN2O6 — CID 19129888
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 19129888) has the molecular formula C35H29Cl2FN2O6 and a molecular weight of 663.53 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 19129888 |
| Molecular Formula | C35H29Cl2FN2O6 |
| Molecular Weight | 663.53 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccccc3F)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C35H29Cl2FN2O6/c1-3-4-13-43-33-26(36)14-22(15-27(33)37)35(41)45-23-10-11-24-30(17-23)46-34(40)25(18-39)32(24)20-9-12-29(31(16-20)42-2)44-19-21-7-5-6-8-28(21)38/h5-12,14-17,32H,3-4,13,19,40H2,1-2H3 |
| InChIKey | RBQXPAYWQIZPLL-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.53 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|