C31H21ClFN3O7 — CID 19127255
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate (PubChem CID 19127255) has the molecular formula C31H21ClFN3O7 and a molecular weight of 601.97 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 19127255 |
| Molecular Formula | C31H21ClFN3O7 |
| Molecular Weight | 601.97 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc([N+](=O)[O-])ccc4Cl)ccc32)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C31H21ClFN3O7/c1-40-28-12-17(6-11-26(28)41-16-18-4-2-3-5-25(18)33)29-21-9-8-20(14-27(21)43-30(35)23(29)15-34)42-31(37)22-13-19(36(38)39)7-10-24(22)32/h2-14,29H,16,35H2,1H3 |
| InChIKey | IMEPQXPIXPINIQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.97 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|