C30H18Cl3N3O6 — CID 19126376
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate (PubChem CID 19126376) has the molecular formula C30H18Cl3N3O6 and a molecular weight of 622.85 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 19126376 |
| Molecular Formula | C30H18Cl3N3O6 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 621.03 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3cc([N+](=O)[O-])ccc3Cl)ccc2C1c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C30H18Cl3N3O6/c31-18-4-1-17(26(33)11-18)15-40-20-6-2-16(3-7-20)28-22-9-8-21(13-27(22)42-29(35)24(28)14-34)41-30(37)23-12-19(36(38)39)5-10-25(23)32/h1-13,28H,15,35H2 |
| InChIKey | XAGNEXJDZCUTGU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|