C28H24ClN3O6 — CID 19125418
[2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate (PubChem CID 19125418) has the molecular formula C28H24ClN3O6 and a molecular weight of 533.97 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 19125418 |
| Molecular Formula | C28H24ClN3O6 |
| Molecular Weight | 533.97 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
| SMILES | CCCCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc([N+](=O)[O-])ccc4Cl)ccc32)c1 |
| InChI | InChI=1S/C28H24ClN3O6/c1-2-3-4-12-36-19-7-5-6-17(13-19)26-21-10-9-20(15-25(21)38-27(31)23(26)16-30)37-28(33)22-14-18(32(34)35)8-11-24(22)29/h5-11,13-15,26H,2-4,12,31H2,1H3 |
| InChIKey | GJQIPVJMMINGAF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.97 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|