C31H31N3O7 — CID 19125097
[2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-nitrobenzoate (PubChem CID 19125097) has the molecular formula C31H31N3O7 and a molecular weight of 557.60 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 19125097 |
| Molecular Formula | C31H31N3O7 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-nitrobenzoate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc([N+](=O)[O-])c4)ccc32)cc1OC |
| InChI | InChI=1S/C31H31N3O7/c1-3-4-5-6-7-15-39-26-14-11-20(17-28(26)38-2)29-24-13-12-23(18-27(24)41-30(33)25(29)19-32)40-31(35)21-9-8-10-22(16-21)34(36)37/h8-14,16-18,29H,3-7,15,33H2,1-2H3 |
| InChIKey | ARENDTRLYADDDV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|