C31H32N2O5 — CID 19125744
[2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate (PubChem CID 19125744) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19125744 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc(OC)c4)ccc32)cc1 |
| InChI | InChI=1S/C31H32N2O5/c1-3-4-5-6-7-17-36-23-13-11-21(12-14-23)29-26-16-15-25(19-28(26)38-30(33)27(29)20-32)37-31(34)22-9-8-10-24(18-22)35-2/h8-16,18-19,29H,3-7,17,33H2,1-2H3 |
| InChIKey | KAPXNWLDUMFXMO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|