C35H40N2O6 — CID 19125079
[2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-butoxybenzoate (PubChem CID 19125079) has the molecular formula C35H40N2O6 and a molecular weight of 584.71 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-butoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-butoxybenzoate |
|---|---|
| PubChem CID | 19125079 |
| Molecular Formula | C35H40N2O6 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3-butoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc(OCCCC)c4)ccc32)cc1OC |
| InChI | InChI=1S/C35H40N2O6/c1-4-6-8-9-10-19-41-30-17-14-24(21-32(30)39-3)33-28-16-15-27(22-31(28)43-34(37)29(33)23-36)42-35(38)25-12-11-13-26(20-25)40-18-7-5-2/h11-17,20-22,33H,4-10,18-19,37H2,1-3H3 |
| InChIKey | GOCRZYJYJHCMTQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|