C25H20N2O5 — CID 19120952
[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate (PubChem CID 19120952) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19120952 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C25H20N2O5/c1-29-17-7-3-5-15(11-17)23-20-10-9-19(13-22(20)32-24(27)21(23)14-26)31-25(28)16-6-4-8-18(12-16)30-2/h3-13,23H,27H2,1-2H3 |
| InChIKey | WYDFGGAEDRZMEV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|