C24H16ClFN2O4 — CID 19124066
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 3-methoxybenzoate (PubChem CID 19124066) has the molecular formula C24H16ClFN2O4 and a molecular weight of 450.85 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 3-methoxybenzoate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19124066 |
| Molecular Formula | C24H16ClFN2O4 |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C24H16ClFN2O4/c1-30-14-5-2-4-13(10-14)24(29)31-15-8-9-16-20(11-15)32-23(28)17(12-27)21(16)22-18(25)6-3-7-19(22)26/h2-11,21H,28H2,1H3 |
| InChIKey | HENCIVIQBQEMKD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|