C21H12ClFN2O4 — CID 129365843
[(4S)-2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] furan-2-carboxylate (PubChem CID 129365843) has the molecular formula C21H12ClFN2O4 and a molecular weight of 410.79 g/mol. Its IUPAC name is [(4S)-2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] furan-2-carboxylate.
| Compound Name | [(4S)-2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 129365843 |
| Molecular Formula | C21H12ClFN2O4 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | [(4S)-2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] furan-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3ccco3)ccc2[C@@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C21H12ClFN2O4/c22-14-3-1-4-15(23)19(14)18-12-7-6-11(28-21(26)16-5-2-8-27-16)9-17(12)29-20(25)13(18)10-24/h1-9,18H,25H2/t18-/m0/s1 |
| InChIKey | XBFNIHDOSJJLQA-SFHVURJKSA-N |
| XLogP | 4.51 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|