C26H18ClFN2O3 — CID 19124082
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 19124082) has the molecular formula C26H18ClFN2O3 and a molecular weight of 460.89 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19124082 |
| Molecular Formula | C26H18ClFN2O3 |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C26H18ClFN2O3/c1-15-5-7-16(8-6-15)9-12-23(31)32-17-10-11-18-22(13-17)33-26(30)19(14-29)24(18)25-20(27)3-2-4-21(25)28/h2-13,24H,30H2,1H3/b12-9+ |
| InChIKey | WACZHOWFGVLWJG-FMIVXFBMSA-N |
| XLogP | 5.62 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|