C23H12Cl3FN2O3 — CID 19124087
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate (PubChem CID 19124087) has the molecular formula C23H12Cl3FN2O3 and a molecular weight of 489.72 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19124087 |
| Molecular Formula | C23H12Cl3FN2O3 |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3ccc(Cl)cc3Cl)ccc2C1c1c(F)cccc1Cl |
| InChI | InChI=1S/C23H12Cl3FN2O3/c24-11-4-6-13(17(26)8-11)23(30)31-12-5-7-14-19(9-12)32-22(29)15(10-28)20(14)21-16(25)2-1-3-18(21)27/h1-9,20H,29H2 |
| InChIKey | RNOCRGFSPUQWEU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|