C27H22Cl2N2O4 — CID 19124487
[2-amino-4-(2-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate (PubChem CID 19124487) has the molecular formula C27H22Cl2N2O4 and a molecular weight of 509.39 g/mol. Its IUPAC name is [2-amino-4-(2-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate.
| Compound Name | [2-amino-4-(2-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19124487 |
| Molecular Formula | C27H22Cl2N2O4 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [2-amino-4-(2-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 2,4-dichlorobenzoate |
| SMILES | CCCCOc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)c3ccc(Cl)cc3Cl)ccc21 |
| InChI | InChI=1S/C27H22Cl2N2O4/c1-2-3-12-33-23-7-5-4-6-19(23)25-20-11-9-17(14-24(20)35-26(31)21(25)15-30)34-27(32)18-10-8-16(28)13-22(18)29/h4-11,13-14,25H,2-3,12,31H2,1H3 |
| InChIKey | NIGANNFSCOBBBF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|