C32H34N2O4 — CID 19125821
[2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 4-tert-butylbenzoate (PubChem CID 19125821) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 4-tert-butylbenzoate.
| Compound Name | [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 19125821 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 4-tert-butylbenzoate |
| SMILES | CCCCCOc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)c3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C32H34N2O4/c1-5-6-9-18-36-27-11-8-7-10-24(27)29-25-17-16-23(19-28(25)38-30(34)26(29)20-33)37-31(35)21-12-14-22(15-13-21)32(2,3)4/h7-8,10-17,19,29H,5-6,9,18,34H2,1-4H3 |
| InChIKey | AFSHJTXSIRPMNI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|