C29H27BrN2O5 — CID 19125831
[2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate (PubChem CID 19125831) has the molecular formula C29H27BrN2O5 and a molecular weight of 563.45 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 19125831 |
| Molecular Formula | C29H27BrN2O5 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
| SMILES | CCCCCOc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)COc3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C29H27BrN2O5/c1-2-3-6-15-34-25-8-5-4-7-22(25)28-23-14-13-21(16-26(23)37-29(32)24(28)17-31)36-27(33)18-35-20-11-9-19(30)10-12-20/h4-5,7-14,16,28H,2-3,6,15,18,32H2,1H3 |
| InChIKey | MIGKWFGZGLCIMT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|