C31H31BrN2O5 — CID 19125751
[2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate (PubChem CID 19125751) has the molecular formula C31H31BrN2O5 and a molecular weight of 591.50 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 19125751 |
| Molecular Formula | C31H31BrN2O5 |
| Molecular Weight | 591.50 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(Br)cc4)ccc32)cc1 |
| InChI | InChI=1S/C31H31BrN2O5/c1-2-3-4-5-6-17-36-23-11-7-21(8-12-23)30-26-16-15-25(18-28(26)39-31(34)27(30)19-33)38-29(35)20-37-24-13-9-22(32)10-14-24/h7-16,18,30H,2-6,17,20,34H2,1H3 |
| InChIKey | FSXHBADZKXNTGJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.50 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|