C25H20N2O4 — CID 19121105
[2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] benzoate (PubChem CID 19121105) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] benzoate.
| Compound Name | [2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] benzoate |
|---|---|
| PubChem CID | 19121105 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] benzoate |
| SMILES | CCOc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C25H20N2O4/c1-2-29-21-11-7-6-10-18(21)23-19-13-12-17(14-22(19)31-24(27)20(23)15-26)30-25(28)16-8-4-3-5-9-16/h3-14,23H,2,27H2,1H3 |
| InChIKey | CFRNTQVOHLTUOU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|