C32H26N2O5 — CID 139582135
[2-amino-3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] benzoate (PubChem CID 139582135) has the molecular formula C32H26N2O5 and a molecular weight of 518.57 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] benzoate.
| Compound Name | [2-amino-3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] benzoate |
|---|---|
| PubChem CID | 139582135 |
| Molecular Formula | C32H26N2O5 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | [2-amino-3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] benzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4)ccc32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H26N2O5/c1-2-36-29-17-23(13-16-27(29)37-20-21-9-5-3-6-10-21)30-25-15-14-24(18-28(25)39-31(34)26(30)19-33)38-32(35)22-11-7-4-8-12-22/h3-18,30H,2,20,34H2,1H3 |
| InChIKey | ZUXNAYVRLXNNCK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|