C36H34N2O6 — CID 19127457
[2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-propoxybenzoate (PubChem CID 19127457) has the molecular formula C36H34N2O6 and a molecular weight of 590.68 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 19127457 |
| Molecular Formula | C36H34N2O6 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(C)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C36H34N2O6/c1-4-18-41-27-13-10-25(11-14-27)36(39)43-28-15-16-29-32(20-28)44-35(38)30(21-37)34(29)26-12-17-31(33(19-26)40-5-2)42-22-24-8-6-23(3)7-9-24/h6-17,19-20,34H,4-5,18,22,38H2,1-3H3 |
| InChIKey | GMSNCDHLGCAPPN-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|