C35H30Cl2N2O6 — CID 19127857
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-propoxybenzoate (PubChem CID 19127857) has the molecular formula C35H30Cl2N2O6 and a molecular weight of 645.54 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 19127857 |
| Molecular Formula | C35H30Cl2N2O6 |
| Molecular Weight | 645.54 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(Cl)cc3Cl)c(OCC)c2)cc1 |
| InChI | InChI=1S/C35H30Cl2N2O6/c1-3-15-42-25-10-6-21(7-11-25)35(40)44-26-12-13-27-31(18-26)45-34(39)28(19-38)33(27)22-8-14-30(32(16-22)41-4-2)43-20-23-5-9-24(36)17-29(23)37/h5-14,16-18,33H,3-4,15,20,39H2,1-2H3 |
| InChIKey | JTEXYIKQHBJDGR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.54 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|