C37H34Cl2N2O6 — CID 19127870
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 19127870) has the molecular formula C37H34Cl2N2O6 and a molecular weight of 673.59 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 19127870 |
| Molecular Formula | C37H34Cl2N2O6 |
| Molecular Weight | 673.59 g/mol |
| Exact Mass | 672.18 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(C(C)(C)C)cc4)ccc32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H34Cl2N2O6/c1-5-43-33-16-22(7-15-31(33)45-20-23-6-10-25(38)17-30(23)39)35-28-14-13-27(18-32(28)47-36(41)29(35)19-40)46-34(42)21-44-26-11-8-24(9-12-26)37(2,3)4/h6-18,35H,5,20-21,41H2,1-4H3 |
| InChIKey | UGXUAGPGSSQBQJ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.59 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|