C34H29ClN2O7 — CID 19127515
[2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-methoxyphenoxy)acetate (PubChem CID 19127515) has the molecular formula C34H29ClN2O7 and a molecular weight of 613.07 g/mol. Its IUPAC name is [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 19127515 |
| Molecular Formula | C34H29ClN2O7 |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-methoxyphenoxy)acetate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4OC)ccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C34H29ClN2O7/c1-3-40-31-16-21(12-15-29(31)41-19-22-8-4-5-9-26(22)35)33-24-14-13-23(17-30(24)44-34(37)25(33)18-36)43-32(38)20-42-28-11-7-6-10-27(28)39-2/h4-17,33H,3,19-20,37H2,1-2H3 |
| InChIKey | FXFXOVFEPUMCBT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|