C33H26Cl2N2O6 — CID 19127535
[2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-chlorophenoxy)acetate (PubChem CID 19127535) has the molecular formula C33H26Cl2N2O6 and a molecular weight of 617.49 g/mol. Its IUPAC name is [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 19127535 |
| Molecular Formula | C33H26Cl2N2O6 |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(2-chlorophenoxy)acetate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4Cl)ccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C33H26Cl2N2O6/c1-2-39-30-15-20(11-14-28(30)40-18-21-7-3-4-8-25(21)34)32-23-13-12-22(16-29(23)43-33(37)24(32)17-36)42-31(38)19-41-27-10-6-5-9-26(27)35/h3-16,32H,2,18-19,37H2,1H3 |
| InChIKey | YRRBRVQSHCADOW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|