C31H23ClN2O5 — CID 19126551
[2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-phenoxyacetate (PubChem CID 19126551) has the molecular formula C31H23ClN2O5 and a molecular weight of 538.99 g/mol. Its IUPAC name is [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-phenoxyacetate.
| Compound Name | [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 19126551 |
| Molecular Formula | C31H23ClN2O5 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-phenoxyacetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccccc3)ccc2C1c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C31H23ClN2O5/c32-27-12-5-4-7-21(27)18-36-23-11-6-8-20(15-23)30-25-14-13-24(16-28(25)39-31(34)26(30)17-33)38-29(35)19-37-22-9-2-1-3-10-22/h1-16,30H,18-19,34H2 |
| InChIKey | YAIVFVJAFZZGBY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|