C31H18Cl6N2O5 — CID 19126607
[2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate (PubChem CID 19126607) has the molecular formula C31H18Cl6N2O5 and a molecular weight of 711.21 g/mol. Its IUPAC name is [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate.
| Compound Name | [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
|---|---|
| PubChem CID | 19126607 |
| Molecular Formula | C31H18Cl6N2O5 |
| Molecular Weight | 711.21 g/mol |
| Exact Mass | 707.93 |
| IUPAC Name | [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)ccc2C1c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C31H18Cl6N2O5/c32-21-7-2-1-4-16(21)13-41-17-6-3-5-15(10-17)24-19-9-8-18(11-22(19)44-31(39)20(24)12-38)43-23(40)14-42-30-28(36)26(34)25(33)27(35)29(30)37/h1-11,24H,13-14,39H2 |
| InChIKey | DTIPIGTYFDKJQC-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.21 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|