C27H19Cl5N2O4 — CID 19120776
[2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate (PubChem CID 19120776) has the molecular formula C27H19Cl5N2O4 and a molecular weight of 612.72 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
|---|---|
| PubChem CID | 19120776 |
| Molecular Formula | C27H19Cl5N2O4 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 609.98 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propan-2-ylphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
| SMILES | CC(C)c1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)ccc32)cc1 |
| InChI | InChI=1S/C27H19Cl5N2O4/c1-12(2)13-3-5-14(6-4-13)20-16-8-7-15(9-18(16)38-27(34)17(20)10-33)37-19(35)11-36-26-24(31)22(29)21(28)23(30)25(26)32/h3-9,12,20H,11,34H2,1-2H3 |
| InChIKey | WTTTVXWDSXYUKW-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|