C26H17Cl5N2O6 — CID 19123091
[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate (PubChem CID 19123091) has the molecular formula C26H17Cl5N2O6 and a molecular weight of 630.69 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
|---|---|
| PubChem CID | 19123091 |
| Molecular Formula | C26H17Cl5N2O6 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 627.95 |
| IUPAC Name | [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)ccc32)c1 |
| InChI | InChI=1S/C26H17Cl5N2O6/c1-35-11-4-6-16(36-2)14(7-11)19-13-5-3-12(8-17(13)39-26(33)15(19)9-32)38-18(34)10-37-25-23(30)21(28)20(27)22(29)24(25)31/h3-8,19H,10,33H2,1-2H3 |
| InChIKey | LZRXKLNHFQTSSM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|