C25H19ClN2O5 — CID 19120942
[2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 19120942) has the molecular formula C25H19ClN2O5 and a molecular weight of 462.89 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 19120942 |
| Molecular Formula | C25H19ClN2O5 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | COc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)COc3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C25H19ClN2O5/c1-30-21-8-3-2-7-18(21)24-19-10-9-17(12-22(19)33-25(28)20(24)13-27)32-23(29)14-31-16-6-4-5-15(26)11-16/h2-12,24H,14,28H2,1H3 |
| InChIKey | LPPYQDMWGJMSOC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|