C24H16Cl2N2O4 — CID 19121437
[2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenoxy)acetate (PubChem CID 19121437) has the molecular formula C24H16Cl2N2O4 and a molecular weight of 467.31 g/mol. Its IUPAC name is [2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 19121437 |
| Molecular Formula | C24H16Cl2N2O4 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | [2-amino-4-(2-chlorophenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chlorophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccc(Cl)cc3)ccc2C1c1ccccc1Cl |
| InChI | InChI=1S/C24H16Cl2N2O4/c25-14-5-7-15(8-6-14)30-13-22(29)31-16-9-10-18-21(11-16)32-24(28)19(12-27)23(18)17-3-1-2-4-20(17)26/h1-11,23H,13,28H2 |
| InChIKey | ZZPQRCHITLFVDP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|