C31H22Cl2N2O5 — CID 19126871
[2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-phenoxyacetate (PubChem CID 19126871) has the molecular formula C31H22Cl2N2O5 and a molecular weight of 573.43 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-phenoxyacetate.
| Compound Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 19126871 |
| Molecular Formula | C31H22Cl2N2O5 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-phenoxyacetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccccc3)ccc2C1c1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C31H22Cl2N2O5/c32-21-10-9-20(27(33)14-21)17-37-23-8-4-5-19(13-23)30-25-12-11-24(15-28(25)40-31(35)26(30)16-34)39-29(36)18-38-22-6-2-1-3-7-22/h1-15,30H,17-18,35H2 |
| InChIKey | VSVMMFJQWBTTNJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|