C31H21BrCl2N2O5 — CID 19126870
[2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate (PubChem CID 19126870) has the molecular formula C31H21BrCl2N2O5 and a molecular weight of 652.33 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 19126870 |
| Molecular Formula | C31H21BrCl2N2O5 |
| Molecular Weight | 652.33 g/mol |
| Exact Mass | 650.00 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccc(Br)cc3)ccc2C1c1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C31H21BrCl2N2O5/c32-20-5-8-22(9-6-20)39-17-29(37)40-24-10-11-25-28(14-24)41-31(36)26(15-35)30(25)18-2-1-3-23(12-18)38-16-19-4-7-21(33)13-27(19)34/h1-14,30H,16-17,36H2 |
| InChIKey | DTQNBBIWFGALOM-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.33 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|