C32H21Cl3N2O4 — CID 19126878
[2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 19126878) has the molecular formula C32H21Cl3N2O4 and a molecular weight of 603.89 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19126878 |
| Molecular Formula | C32H21Cl3N2O4 |
| Molecular Weight | 603.89 g/mol |
| Exact Mass | 602.06 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)/C=C/c3ccc(Cl)cc3)ccc2C1c1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C32H21Cl3N2O4/c33-22-8-4-19(5-9-22)6-13-30(38)40-25-11-12-26-29(16-25)41-32(37)27(17-36)31(26)20-2-1-3-24(14-20)39-18-21-7-10-23(34)15-28(21)35/h1-16,31H,18,37H2/b13-6+ |
| InChIKey | PSPHAVRJUUFPLU-AWNIVKPZSA-N |
| XLogP | 8.06 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.89 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|