C28H18Cl2N2O5 — CID 19126327
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate (PubChem CID 19126327) has the molecular formula C28H18Cl2N2O5 and a molecular weight of 533.37 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19126327 |
| Molecular Formula | C28H18Cl2N2O5 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3ccco3)ccc2C1c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H18Cl2N2O5/c29-18-6-3-17(23(30)12-18)15-35-19-7-4-16(5-8-19)26-21-10-9-20(36-28(33)24-2-1-11-34-24)13-25(21)37-27(32)22(26)14-31/h1-13,26H,15,32H2 |
| InChIKey | WNMLFRNQOMAMOI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|