C30H19Cl2FN2O4 — CID 19126309
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-fluorobenzoate (PubChem CID 19126309) has the molecular formula C30H19Cl2FN2O4 and a molecular weight of 561.40 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-fluorobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 19126309 |
| Molecular Formula | C30H19Cl2FN2O4 |
| Molecular Weight | 561.40 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-fluorobenzoate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3ccc(F)cc3)ccc2C1c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C30H19Cl2FN2O4/c31-20-6-1-19(26(32)13-20)16-37-22-9-4-17(5-10-22)28-24-12-11-23(14-27(24)39-29(35)25(28)15-34)38-30(36)18-2-7-21(33)8-3-18/h1-14,28H,16,35H2 |
| InChIKey | ZOGVKPSVQJLLDX-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.40 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|