C34H29FN2O5 — CID 19126179
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butoxybenzoate (PubChem CID 19126179) has the molecular formula C34H29FN2O5 and a molecular weight of 564.61 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 19126179 |
| Molecular Formula | C34H29FN2O5 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C34H29FN2O5/c1-2-3-18-39-25-14-10-23(11-15-25)34(38)41-27-16-17-28-31(19-27)42-33(37)29(20-36)32(28)22-8-12-26(13-9-22)40-21-24-6-4-5-7-30(24)35/h4-17,19,32H,2-3,18,21,37H2,1H3 |
| InChIKey | ATNGGUPFHQZKLB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|