C34H35FN2O4 — CID 19129584
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 19129584) has the molecular formula C34H35FN2O4 and a molecular weight of 554.66 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19129584 |
| Molecular Formula | C34H35FN2O4 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C34H35FN2O4/c1-2-3-6-22-9-11-24(12-10-22)34(38)40-27-17-18-28-31(19-27)41-33(37)29(20-36)32(28)23-13-15-26(16-14-23)39-21-25-7-4-5-8-30(25)35/h4-5,7-8,13-19,22,24,32H,2-3,6,9-12,21,37H2,1H3 |
| InChIKey | JZKVZEWJLYKKAX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|