C33H42N2O5 — CID 19128744
[2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 19128744) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19128744 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCCC(C)C)c(OC)c2)CC1 |
| InChI | InChI=1S/C33H42N2O5/c1-5-6-7-22-8-10-23(11-9-22)33(36)39-25-13-14-26-29(19-25)40-32(35)27(20-34)31(26)24-12-15-28(30(18-24)37-4)38-17-16-21(2)3/h12-15,18-19,21-23,31H,5-11,16-17,35H2,1-4H3 |
| InChIKey | CXOJKDNOJVALDQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|