C35H37ClN2O5 — CID 19129872
[2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 19129872) has the molecular formula C35H37ClN2O5 and a molecular weight of 601.14 g/mol. Its IUPAC name is [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19129872 |
| Molecular Formula | C35H37ClN2O5 |
| Molecular Weight | 601.14 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(Cl)cc3)c(OC)c2)CC1 |
| InChI | InChI=1S/C35H37ClN2O5/c1-3-4-5-22-6-10-24(11-7-22)35(39)42-27-15-16-28-31(19-27)43-34(38)29(20-37)33(28)25-12-17-30(32(18-25)40-2)41-21-23-8-13-26(36)14-9-23/h8-9,12-19,22,24,33H,3-7,10-11,21,38H2,1-2H3 |
| InChIKey | HNUQECAJQUWEET-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.14 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|