C32H24BrClN2O6 — CID 19127110
[2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate (PubChem CID 19127110) has the molecular formula C32H24BrClN2O6 and a molecular weight of 647.91 g/mol. Its IUPAC name is [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 19127110 |
| Molecular Formula | C32H24BrClN2O6 |
| Molecular Weight | 647.91 g/mol |
| Exact Mass | 646.05 |
| IUPAC Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(Br)cc4)ccc32)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H24BrClN2O6/c1-38-29-14-20(4-13-27(29)40-17-19-2-7-22(34)8-3-19)31-25-12-11-24(15-28(25)42-32(36)26(31)16-35)41-30(37)18-39-23-9-5-21(33)6-10-23/h2-15,31H,17-18,36H2,1H3 |
| InChIKey | YKYVDXXXIJLZSB-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.91 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|