C32H25FN2O6 — CID 19127271
[2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-phenoxyacetate (PubChem CID 19127271) has the molecular formula C32H25FN2O6 and a molecular weight of 552.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-phenoxyacetate.
| Compound Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 19127271 |
| Molecular Formula | C32H25FN2O6 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-phenoxyacetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4)ccc32)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C32H25FN2O6/c1-37-29-15-21(9-14-27(29)39-18-20-7-10-22(33)11-8-20)31-25-13-12-24(16-28(25)41-32(35)26(31)17-34)40-30(36)19-38-23-5-3-2-4-6-23/h2-16,31H,18-19,35H2,1H3 |
| InChIKey | OFHFCGSRQCVFRJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|