C34H29ClN2O6 — CID 19127160
[2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-ethylphenoxy)acetate (PubChem CID 19127160) has the molecular formula C34H29ClN2O6 and a molecular weight of 597.07 g/mol. Its IUPAC name is [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-ethylphenoxy)acetate.
| Compound Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 19127160 |
| Molecular Formula | C34H29ClN2O6 |
| Molecular Weight | 597.07 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | [2-amino-4-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-(4-ethylphenoxy)acetate |
| SMILES | CCc1ccc(OCC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(Cl)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C34H29ClN2O6/c1-3-21-6-11-25(12-7-21)40-20-32(38)42-26-13-14-27-30(17-26)43-34(37)28(18-36)33(27)23-8-15-29(31(16-23)39-2)41-19-22-4-9-24(35)10-5-22/h4-17,33H,3,19-20,37H2,1-2H3 |
| InChIKey | JRHVMGIQIQGOGT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.07 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|