C26H20Cl2N2O6 — CID 19122720
[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 19122720) has the molecular formula C26H20Cl2N2O6 and a molecular weight of 527.36 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 19122720 |
| Molecular Formula | C26H20Cl2N2O6 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(Cl)cc4Cl)ccc32)cc1OC |
| InChI | InChI=1S/C26H20Cl2N2O6/c1-32-21-7-3-14(9-23(21)33-2)25-17-6-5-16(11-22(17)36-26(30)18(25)12-29)35-24(31)13-34-20-8-4-15(27)10-19(20)28/h3-11,25H,13,30H2,1-2H3 |
| InChIKey | LLWHJBSBTUOLOF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|