C32H24ClFN2O6 — CID 19127253
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 19127253) has the molecular formula C32H24ClFN2O6 and a molecular weight of 587.00 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 19127253 |
| Molecular Formula | C32H24ClFN2O6 |
| Molecular Weight | 587.00 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4cccc(Cl)c4)ccc32)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C32H24ClFN2O6/c1-38-29-13-19(9-12-27(29)40-17-20-5-2-3-8-26(20)34)31-24-11-10-23(15-28(24)42-32(36)25(31)16-35)41-30(37)18-39-22-7-4-6-21(33)14-22/h2-15,31H,17-18,36H2,1H3 |
| InChIKey | OIUKWMQLUYNXJW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.00 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|