C27H23ClN2O6 — CID 19123017
[2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 19123017) has the molecular formula C27H23ClN2O6 and a molecular weight of 506.94 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 19123017 |
| Molecular Formula | C27H23ClN2O6 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4cccc(Cl)c4)ccc32)cc1OC |
| InChI | InChI=1S/C27H23ClN2O6/c1-3-33-22-10-7-16(11-24(22)32-2)26-20-9-8-19(13-23(20)36-27(30)21(26)14-29)35-25(31)15-34-18-6-4-5-17(28)12-18/h4-13,26H,3,15,30H2,1-2H3 |
| InChIKey | ODPPOTZJEAFPPT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|