C32H24FN3O8 — CID 19127194
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate (PubChem CID 19127194) has the molecular formula C32H24FN3O8 and a molecular weight of 597.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 19127194 |
| Molecular Formula | C32H24FN3O8 |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccccc4[N+](=O)[O-])ccc32)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C32H24FN3O8/c1-40-29-14-19(10-13-27(29)41-17-20-6-2-3-7-24(20)33)31-22-12-11-21(15-28(22)44-32(35)23(31)16-34)43-30(37)18-42-26-9-5-4-8-25(26)36(38)39/h2-15,31H,17-18,35H2,1H3 |
| InChIKey | OGQGEMIJCFDUBP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|