C31H22FN3O7 — CID 19126235
[2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate (PubChem CID 19126235) has the molecular formula C31H22FN3O7 and a molecular weight of 567.53 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 19126235 |
| Molecular Formula | C31H22FN3O7 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(4-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(2-nitrophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccccc3[N+](=O)[O-])ccc2C1c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C31H22FN3O7/c32-21-9-5-19(6-10-21)17-39-22-11-7-20(8-12-22)30-24-14-13-23(15-28(24)42-31(34)25(30)16-33)41-29(36)18-40-27-4-2-1-3-26(27)35(37)38/h1-15,30H,17-18,34H2 |
| InChIKey | RGLZIMIDSPKEDU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|